C35H36N4O3 — CID 58958972
2-[[(5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[4-(4-ethoxyphenyl)butyl]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzonitrile (PubChem CID 58958972) has the molecular formula C35H36N4O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is 2-[[(5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[4-(4-ethoxyphenyl)butyl]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzonitrile.
| Compound Name | 2-[[(5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[4-(4-ethoxyphenyl)butyl]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzonitrile |
|---|---|
| PubChem CID | 58958972 |
| Molecular Formula | C35H36N4O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[[(5E)-5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylidene)-3-[4-(4-ethoxyphenyl)butyl]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzonitrile |
| SMILES | CCOc1ccc(CCCCN2C(=O)/C(=C\c3cc4c5c(c3)CCCN5CCC4)O/C2=N\c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C35H36N4O3/c1-2-41-30-16-14-25(15-17-30)9-5-6-20-39-34(40)32(42-35(39)37-31-13-4-3-10-29(31)24-36)23-26-21-27-11-7-18-38-19-8-12-28(22-26)33(27)38/h3-4,10,13-17,21-23H,2,5-9,11-12,18-20H2,1H3/b32-23+,37-35- |
| InChIKey | QKGSTJHDUMUFDH-QRSZBNODSA-N |
| XLogP | 6.57 |
| TPSA | 78.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|