About (3S,4R)-1-tert-butylpyrrolidine-3,4-diol
(3S,4R)-1-tert-butylpyrrolidine-3,4-diol (PubChem CID 58959474) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is (3S,4R)-1-tert-butylpyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | (3S,4R)-1-tert-butylpyrrolidine-3,4-diol |
| PubChem CID | 58959474 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3S,4R)-1-tert-butylpyrrolidine-3,4-diol |
| SMILES | CC(C)(C)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H17NO2/c1-8(2,3)9-4-6(10)7(11)5-9/h6-7,10-11H,4-5H2,1-3H3/t6-,7+ |
| InChIKey | OUENLUVFKQHXBX-KNVOCYPGSA-N |
| XLogP | -0.18 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-1-tert-butylpyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-tert-butylpyrrolidine-3,4-diol?
The IUPAC name of (3S,4R)-1-tert-butylpyrrolidine-3,4-diol (CID 58959474) is (3S,4R)-1-tert-butylpyrrolidine-3,4-diol.
What is the SMILES notation for (3S,4R)-1-tert-butylpyrrolidine-3,4-diol?
The canonical SMILES for (3S,4R)-1-tert-butylpyrrolidine-3,4-diol is CC(C)(C)N1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of (3S,4R)-1-tert-butylpyrrolidine-3,4-diol?
The InChIKey is OUENLUVFKQHXBX-KNVOCYPGSA-N. The full InChI is InChI=1S/C8H17NO2/c1-8(2,3)9-4-6(10)7(11)5-9/h6-7,10-11H,4-5H2,1-3H3/t6-,7+.
What are the key properties of (3S,4R)-1-tert-butylpyrrolidine-3,4-diol?
(3S,4R)-1-tert-butylpyrrolidine-3,4-diol has a molecular weight of 159.23 g/mol, XLogP of -0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-tert-butylpyrrolidine-3,4-diol is sourced from PubChem (CID 58959474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).