C11H23NO2 — CID 58959504
(3R,4S)-1-tert-butyl-4-propan-2-yloxypyrrolidin-3-ol (PubChem CID 58959504) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-4-propan-2-yloxypyrrolidin-3-ol.
| Compound Name | (3R,4S)-1-tert-butyl-4-propan-2-yloxypyrrolidin-3-ol |
|---|---|
| PubChem CID | 58959504 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (3R,4S)-1-tert-butyl-4-propan-2-yloxypyrrolidin-3-ol |
| SMILES | CC(C)O[C@H]1CN(C(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C11H23NO2/c1-8(2)14-10-7-12(6-9(10)13)11(3,4)5/h8-10,13H,6-7H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | NZHIDUBVKDUDHW-ZJUUUORDSA-N |
| XLogP | 1.25 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |