About rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans
rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans (PubChem CID 58959528) has the molecular formula C9H19NO
and a molecular weight of 157.25 g/mol. Its IUPAC name is cis-(1R,2S)-2-(tert-butylamino)cyclopentan-1-ol.
Analyze rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans?
The IUPAC name of rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans (CID 58959528) is cis-(1R,2S)-2-(tert-butylamino)cyclopentan-1-ol.
What is the SMILES notation for rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans?
The canonical SMILES for rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans is CC(C)(C)N[C@H]1CCC[C@H]1O.
What is the InChIKey of rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans?
The InChIKey is QERSUMFLRHQPON-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H19NO/c1-9(2,3)10-7-5-4-6-8(7)11/h7-8,10-11H,4-6H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans?
rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans has a molecular weight of 157.25 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for rac-(1R,2R)-2-(tert-butylamino)cyclopentan-1-ol,trans is sourced from PubChem (CID 58959528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).