C10H20O6Si2 — CID 589596
3,6-bis(trimethylsilyloxy)-1,4-dioxane-2,5-dione (PubChem CID 589596) has the molecular formula C10H20O6Si2 and a molecular weight of 292.44 g/mol. Its IUPAC name is 3,6-bis(trimethylsilyloxy)-1,4-dioxane-2,5-dione.
| Compound Name | 3,6-bis(trimethylsilyloxy)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 589596 |
| Molecular Formula | C10H20O6Si2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3,6-bis(trimethylsilyloxy)-1,4-dioxane-2,5-dione |
| SMILES | C[Si](C)(C)OC1OC(=O)C(O[Si](C)(C)C)OC1=O |
| InChI | InChI=1S/C10H20O6Si2/c1-17(2,3)15-9-7(11)14-10(8(12)13-9)16-18(4,5)6/h9-10H,1-6H3 |
| InChIKey | KZIHDJSOLDEFGJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|