About 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine
3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 58959666) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine.
Molecular Properties
| Compound Name | 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine |
| PubChem CID | 58959666 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | c1ccc(Cc2nnc3ccc(Oc4ccccc4)nn23)cc1 |
| InChI | InChI=1S/C18H14N4O/c1-3-7-14(8-4-1)13-17-20-19-16-11-12-18(21-22(16)17)23-15-9-5-2-6-10-15/h1-12H,13H2 |
| InChIKey | FBWZEWVUPPOANH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine?
The IUPAC name of 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine (CID 58959666) is 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine.
What is the SMILES notation for 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine?
The canonical SMILES for 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine is c1ccc(Cc2nnc3ccc(Oc4ccccc4)nn23)cc1.
What is the InChIKey of 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine?
The InChIKey is FBWZEWVUPPOANH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4O/c1-3-7-14(8-4-1)13-17-20-19-16-11-12-18(21-22(16)17)23-15-9-5-2-6-10-15/h1-12H,13H2.
What are the key properties of 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine?
3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine has a molecular weight of 302.34 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-phenoxy-[1,2,4]triazolo[4,3-b]pyridazine is sourced from PubChem (CID 58959666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).