About N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide
N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide (PubChem CID 58960376) has the molecular formula C14H17Cl2N3O2S
and a molecular weight of 362.28 g/mol. Its IUPAC name is N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide |
| PubChem CID | 58960376 |
| Molecular Formula | C14H17Cl2N3O2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide |
| SMILES | CCCc1cc(Cl)c(-n2nc(C)cc2NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2N3O2S/c1-4-5-10-7-11(15)14(12(16)8-10)19-13(6-9(2)17-19)18-22(3,20)21/h6-8,18H,4-5H2,1-3H3 |
| InChIKey | PJXPVKBQMTWGJP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide?
The IUPAC name of N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide (CID 58960376) is N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide.
What is the SMILES notation for N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide?
The canonical SMILES for N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide is CCCc1cc(Cl)c(-n2nc(C)cc2NS(C)(=O)=O)c(Cl)c1.
What is the InChIKey of N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide?
The InChIKey is PJXPVKBQMTWGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3O2S/c1-4-5-10-7-11(15)14(12(16)8-10)19-13(6-9(2)17-19)18-22(3,20)21/h6-8,18H,4-5H2,1-3H3.
What are the key properties of N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide?
N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide has a molecular weight of 362.28 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dichloro-4-propylphenyl)-5-methylpyrazol-3-yl]methanesulfonamide is sourced from PubChem (CID 58960376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).