C16H24N2O5 — CID 58960825
(2S,3R,6R)-6-[[(3S)-2-amino-3-hydroxy-3-phenylpropyl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 58960825) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2S,3R,6R)-6-[[(3S)-2-amino-3-hydroxy-3-phenylpropyl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (2S,3R,6R)-6-[[(3S)-2-amino-3-hydroxy-3-phenylpropyl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 58960825 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (2S,3R,6R)-6-[[(3S)-2-amino-3-hydroxy-3-phenylpropyl]amino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | NC(CN[C@@H]1C=C(CO)[C@@H](O)[C@H](O)C1O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O5/c17-11(13(20)9-4-2-1-3-5-9)7-18-12-6-10(8-19)14(21)16(23)15(12)22/h1-6,11-16,18-23H,7-8,17H2/t11?,12-,13+,14-,15?,16+/m1/s1 |
| InChIKey | WUKURFQTHBMELE-QHYNVCIGSA-N |
| XLogP | -1.98 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|