About 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole
2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole (PubChem CID 58961033) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole.
Molecular Properties
| Compound Name | 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole |
| PubChem CID | 58961033 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole |
| SMILES | Cc1c2c(nn1C)CSCC2 |
| InChI | InChI=1S/C8H12N2S/c1-6-7-3-4-11-5-8(7)9-10(6)2/h3-5H2,1-2H3 |
| InChIKey | JBFLGCWSUIQONB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole?
The IUPAC name of 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole (CID 58961033) is 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole.
What is the SMILES notation for 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole?
The canonical SMILES for 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole is Cc1c2c(nn1C)CSCC2.
What is the InChIKey of 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole?
The InChIKey is JBFLGCWSUIQONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-6-7-3-4-11-5-8(7)9-10(6)2/h3-5H2,1-2H3.
What are the key properties of 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole?
2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole has a molecular weight of 168.26 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5,7-dihydro-4H-thiopyrano[3,4-c]pyrazole is sourced from PubChem (CID 58961033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).