About 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole
3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole (PubChem CID 58961072) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole.
Analyze 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole?
The IUPAC name of 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole (CID 58961072) is 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole.
What is the SMILES notation for 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole?
The canonical SMILES for 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole is Cc1[nH]nc2c1CCSC2.
What is the InChIKey of 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole?
The InChIKey is VRYRCTFEBAJPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c1-5-6-2-3-10-4-7(6)9-8-5/h2-4H2,1H3,(H,8,9).
What are the key properties of 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole?
3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole has a molecular weight of 154.24 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4,5,7-tetrahydrothiopyrano[3,4-c]pyrazole is sourced from PubChem (CID 58961072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).