About 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate
2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate (PubChem CID 58961374) has the molecular formula C10H22O3S
and a molecular weight of 222.35 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate |
| PubChem CID | 58961374 |
| Molecular Formula | C10H22O3S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate |
| SMILES | CC(C)(C)COS(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H22O3S/c1-9(2,3)7-13-14(11,12)8-10(4,5)6/h7-8H2,1-6H3 |
| InChIKey | JNNAHTFJQZZTBO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate?
The IUPAC name of 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate (CID 58961374) is 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate.
What is the SMILES notation for 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate?
The canonical SMILES for 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate is CC(C)(C)COS(=O)(=O)CC(C)(C)C.
What is the InChIKey of 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate?
The InChIKey is JNNAHTFJQZZTBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3S/c1-9(2,3)7-13-14(11,12)8-10(4,5)6/h7-8H2,1-6H3.
What are the key properties of 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate?
2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate has a molecular weight of 222.35 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl 2,2-dimethylpropane-1-sulfonate is sourced from PubChem (CID 58961374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).