About 7-methylpteridine
7-methylpteridine (PubChem CID 589615) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 7-methylpteridine.
Molecular Properties
| Compound Name | 7-methylpteridine |
| PubChem CID | 589615 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 7-methylpteridine |
| SMILES | Cc1cnc2cncnc2n1 |
| InChI | InChI=1S/C7H6N4/c1-5-2-9-6-3-8-4-10-7(6)11-5/h2-4H,1H3 |
| InChIKey | KOCYTWBTXZOUFS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylpteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylpteridine?
The IUPAC name of 7-methylpteridine (CID 589615) is 7-methylpteridine.
What is the SMILES notation for 7-methylpteridine?
The canonical SMILES for 7-methylpteridine is Cc1cnc2cncnc2n1.
What is the InChIKey of 7-methylpteridine?
The InChIKey is KOCYTWBTXZOUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-5-2-9-6-3-8-4-10-7(6)11-5/h2-4H,1H3.
What are the key properties of 7-methylpteridine?
7-methylpteridine has a molecular weight of 146.15 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylpteridine is sourced from PubChem (CID 589615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).