C11H16F6O3S — CID 58961852
5-cyclohexyl-1,1,2,2,3,3-hexafluoropentane-1-sulfonic acid (PubChem CID 58961852) has the molecular formula C11H16F6O3S and a molecular weight of 342.30 g/mol. Its IUPAC name is 5-cyclohexyl-1,1,2,2,3,3-hexafluoropentane-1-sulfonic acid.
| Compound Name | 5-cyclohexyl-1,1,2,2,3,3-hexafluoropentane-1-sulfonic acid |
|---|---|
| PubChem CID | 58961852 |
| Molecular Formula | C11H16F6O3S |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 5-cyclohexyl-1,1,2,2,3,3-hexafluoropentane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)CCC1CCCCC1 |
| InChI | InChI=1S/C11H16F6O3S/c12-9(13,7-6-8-4-2-1-3-5-8)10(14,15)11(16,17)21(18,19)20/h8H,1-7H2,(H,18,19,20) |
| InChIKey | RBFSPRNTWMBTHK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|