About [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate
[2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate (PubChem CID 58961906) has the molecular formula C13H6F4O5S
and a molecular weight of 350.25 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate.
Molecular Properties
| Compound Name | [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate |
| PubChem CID | 58961906 |
| Molecular Formula | C13H6F4O5S |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate |
| SMILES | O=C(Oc1c(F)c(F)c(SOOO)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C13H6F4O5S/c14-7-9(16)12(23-22-21-19)10(17)8(15)11(7)20-13(18)6-4-2-1-3-5-6/h1-5,19H |
| InChIKey | AOUWWXQCABBWEJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate?
The IUPAC name of [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate (CID 58961906) is [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate.
What is the SMILES notation for [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate?
The canonical SMILES for [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate is O=C(Oc1c(F)c(F)c(SOOO)c(F)c1F)c1ccccc1.
What is the InChIKey of [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate?
The InChIKey is AOUWWXQCABBWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6F4O5S/c14-7-9(16)12(23-22-21-19)10(17)8(15)11(7)20-13(18)6-4-2-1-3-5-6/h1-5,19H.
What are the key properties of [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate?
[2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate has a molecular weight of 350.25 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,5,6-tetrafluoro-4-(trioxidanylsulfanyl)phenyl] benzoate is sourced from PubChem (CID 58961906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).