C10H11F8O4S- — CID 58961934
2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 58961934) has the molecular formula C10H11F8O4S- and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 58961934 |
| Molecular Formula | C10H11F8O4S- |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-(2-cyclohexyl-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C10H12F8O4S/c11-7(12,6-4-2-1-3-5-6)8(13,14)22-9(15,16)10(17,18)23(19,20)21/h6H,1-5H2,(H,19,20,21)/p-1 |
| InChIKey | NSHCAEKQVYCAOL-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|