About methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate
methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate (PubChem CID 589621) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate |
| PubChem CID | 589621 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSC(C(C)(C)C)N1 |
| InChI | InChI=1S/C9H17NO2S/c1-9(2,3)8-10-6(5-13-8)7(11)12-4/h6,8,10H,5H2,1-4H3 |
| InChIKey | UHABWJACUPYRDB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate?
The IUPAC name of methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate (CID 589621) is methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate is COC(=O)C1CSC(C(C)(C)C)N1.
What is the InChIKey of methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate?
The InChIKey is UHABWJACUPYRDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-9(2,3)8-10-6(5-13-8)7(11)12-4/h6,8,10H,5H2,1-4H3.
What are the key properties of methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate?
methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate has a molecular weight of 203.31 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-tert-butyl-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 589621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).