About 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate
2-methylbut-3-en-2-yl 2,2-dimethylpropanoate (PubChem CID 58962109) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate |
| PubChem CID | 58962109 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate |
| SMILES | C=CC(C)(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H18O2/c1-7-10(5,6)12-8(11)9(2,3)4/h7H,1H2,2-6H3 |
| InChIKey | GQIZUATZCWBHJA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate?
The IUPAC name of 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate (CID 58962109) is 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate?
The canonical SMILES for 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate is C=CC(C)(C)OC(=O)C(C)(C)C.
What is the InChIKey of 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate?
The InChIKey is GQIZUATZCWBHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-7-10(5,6)12-8(11)9(2,3)4/h7H,1H2,2-6H3.
What are the key properties of 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate?
2-methylbut-3-en-2-yl 2,2-dimethylpropanoate has a molecular weight of 170.25 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-yl 2,2-dimethylpropanoate is sourced from PubChem (CID 58962109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).