About 2-ethyl-N,N'-dimethylpropanediamide
2-ethyl-N,N'-dimethylpropanediamide (PubChem CID 58962210) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-ethyl-N,N'-dimethylpropanediamide.
Molecular Properties
| Compound Name | 2-ethyl-N,N'-dimethylpropanediamide |
| PubChem CID | 58962210 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-ethyl-N,N'-dimethylpropanediamide |
| SMILES | CCC(C(=O)NC)C(=O)NC |
| InChI | InChI=1S/C7H14N2O2/c1-4-5(6(10)8-2)7(11)9-3/h5H,4H2,1-3H3,(H,8,10)(H,9,11) |
| InChIKey | PEEBKGXBVLBWOD-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N,N'-dimethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N'-dimethylpropanediamide?
The IUPAC name of 2-ethyl-N,N'-dimethylpropanediamide (CID 58962210) is 2-ethyl-N,N'-dimethylpropanediamide.
What is the SMILES notation for 2-ethyl-N,N'-dimethylpropanediamide?
The canonical SMILES for 2-ethyl-N,N'-dimethylpropanediamide is CCC(C(=O)NC)C(=O)NC.
What is the InChIKey of 2-ethyl-N,N'-dimethylpropanediamide?
The InChIKey is PEEBKGXBVLBWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-4-5(6(10)8-2)7(11)9-3/h5H,4H2,1-3H3,(H,8,10)(H,9,11).
What are the key properties of 2-ethyl-N,N'-dimethylpropanediamide?
2-ethyl-N,N'-dimethylpropanediamide has a molecular weight of 158.20 g/mol, XLogP of -0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N'-dimethylpropanediamide is sourced from PubChem (CID 58962210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).