C8H13F2N — CID 58962880
6,6-difluoro-5-methyl-2-methylidenehex-5-en-1-amine (PubChem CID 58962880) has the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. Its IUPAC name is 6,6-difluoro-5-methyl-2-methylidenehex-5-en-1-amine.
| Compound Name | 6,6-difluoro-5-methyl-2-methylidenehex-5-en-1-amine |
|---|---|
| PubChem CID | 58962880 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 6,6-difluoro-5-methyl-2-methylidenehex-5-en-1-amine |
| SMILES | C=C(CN)CCC(C)=C(F)F |
| InChI | InChI=1S/C8H13F2N/c1-6(5-11)3-4-7(2)8(9)10/h1,3-5,11H2,2H3 |
| InChIKey | WOYSGXCFHCXESU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|