About 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene
1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene (PubChem CID 58962885) has the molecular formula C9H14F2S
and a molecular weight of 192.27 g/mol. Its IUPAC name is 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene.
Molecular Properties
| Compound Name | 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene |
| PubChem CID | 58962885 |
| Molecular Formula | C9H14F2S |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene |
| SMILES | C=C(CCC(C)=C(F)F)CSC |
| InChI | InChI=1S/C9H14F2S/c1-7(6-12-3)4-5-8(2)9(10)11/h1,4-6H2,2-3H3 |
| InChIKey | RJCSAOWJIWCGJR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene?
The IUPAC name of 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene (CID 58962885) is 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene.
What is the SMILES notation for 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene?
The canonical SMILES for 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene is C=C(CCC(C)=C(F)F)CSC.
What is the InChIKey of 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene?
The InChIKey is RJCSAOWJIWCGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2S/c1-7(6-12-3)4-5-8(2)9(10)11/h1,4-6H2,2-3H3.
What are the key properties of 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene?
1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene has a molecular weight of 192.27 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-methyl-5-(methylsulfanylmethyl)hexa-1,5-diene is sourced from PubChem (CID 58962885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).