C9H10Br2N2 — CID 58962980
4,6-dibromo-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 58962980) has the molecular formula C9H10Br2N2 and a molecular weight of 306.00 g/mol. Its IUPAC name is 4,6-dibromo-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 4,6-dibromo-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 58962980 |
| Molecular Formula | C9H10Br2N2 |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.92 |
| IUPAC Name | 4,6-dibromo-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1c(Br)cc2c(c1Br)CCC2N |
| InChI | InChI=1S/C9H10Br2N2/c10-6-3-5-4(1-2-7(5)12)8(11)9(6)13/h3,7H,1-2,12-13H2 |
| InChIKey | JBVKMNLHTLEWRW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|