C19H27NS — CID 58963014
5,6-ditert-butyl-4-thia-6-azatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene (PubChem CID 58963014) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is 5,6-ditert-butyl-4-thia-6-azatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene.
| Compound Name | 5,6-ditert-butyl-4-thia-6-azatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 58963014 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 5,6-ditert-butyl-4-thia-6-azatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene |
| SMILES | CC(C)(C)N1C2Cc3ccccc3C2C2SC21C(C)(C)C |
| InChI | InChI=1S/C19H27NS/c1-17(2,3)19-16(21-19)15-13-10-8-7-9-12(13)11-14(15)20(19)18(4,5)6/h7-10,14-16H,11H2,1-6H3 |
| InChIKey | BZNYJKOAYSTLKP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|