C15H29NS — CID 58963047
1,2-ditert-butyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole (PubChem CID 58963047) has the molecular formula C15H29NS and a molecular weight of 255.47 g/mol. Its IUPAC name is 1,2-ditert-butyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole.
| Compound Name | 1,2-ditert-butyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole |
|---|---|
| PubChem CID | 58963047 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 1,2-ditert-butyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole |
| SMILES | CC(C)(C)C1CC2CCSCC2N1C(C)(C)C |
| InChI | InChI=1S/C15H29NS/c1-14(2,3)13-9-11-7-8-17-10-12(11)16(13)15(4,5)6/h11-13H,7-10H2,1-6H3 |
| InChIKey | INAHDLPYNWPFNJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |