About (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone
(4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 589634) has the molecular formula C14H17N5O
and a molecular weight of 271.32 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone.
Molecular Properties
| Compound Name | (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| PubChem CID | 589634 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H17N5O/c20-14(13-15-11-16-17-13)19-8-6-18(7-9-19)10-12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H,15,16,17) |
| InChIKey | YPDUKPMDFAZLGT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The IUPAC name of (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone (CID 589634) is (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone.
What is the SMILES notation for (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The canonical SMILES for (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone is O=C(c1ncn[nH]1)N1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The InChIKey is YPDUKPMDFAZLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O/c20-14(13-15-11-16-17-13)19-8-6-18(7-9-19)10-12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H,15,16,17).
What are the key properties of (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
(4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone has a molecular weight of 271.32 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone is sourced from PubChem (CID 589634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).