C10H11F9NNaO4S — CID 58963603
sodium 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetate (PubChem CID 58963603) has the molecular formula C10H11F9NNaO4S and a molecular weight of 435.24 g/mol. Its IUPAC name is sodium 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetate.
| Compound Name | sodium 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 58963603 |
| Molecular Formula | C10H11F9NNaO4S |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | sodium 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetate |
| SMILES | CCN(CC(=O)[O-])S(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C10H12F9NO4S.Na/c1-2-20(5-6(21)22)25(23,24)4-3-7(11,12)8(13,14)9(15,16)10(17,18)19;/h2-5H2,1H3,(H,21,22);/q;+1/p-1 |
| InChIKey | YRWQMDXOKBGGHG-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|