C10H12F9NO4S — CID 58963604
2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetic acid (PubChem CID 58963604) has the molecular formula C10H12F9NO4S and a molecular weight of 413.26 g/mol. Its IUPAC name is 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetic acid.
| Compound Name | 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 58963604 |
| Molecular Formula | C10H12F9NO4S |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-[ethyl(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyl)amino]acetic acid |
| SMILES | CCN(CC(=O)O)S(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F9NO4S/c1-2-20(5-6(21)22)25(23,24)4-3-7(11,12)8(13,14)9(15,16)10(17,18)19/h2-5H2,1H3,(H,21,22) |
| InChIKey | RUSWZSKVKFMJKR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|