C18H12F22O6 — CID 58963633
5-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl]-4-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethyl]-4-(trifluoromethyl)octanedioic acid (PubChem CID 58963633) has the molecular formula C18H12F22O6 and a molecular weight of 742.24 g/mol. Its IUPAC name is 5-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl]-4-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethyl]-4-(trifluoromethyl)octanedioic acid.
| Compound Name | 5-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl]-4-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethyl]-4-(trifluoromethyl)octanedioic acid |
|---|---|
| PubChem CID | 58963633 |
| Molecular Formula | C18H12F22O6 |
| Molecular Weight | 742.24 g/mol |
| Exact Mass | 742.03 |
| IUPAC Name | 5-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethyl]-4-[1,1,2,2-tetrafluoro-2-(1,2,2,2-tetrafluoroethoxy)ethyl]-4-(trifluoromethyl)octanedioic acid |
| SMILES | O=C(O)CCC(C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)C(CCC(=O)O)(C(F)(F)F)C(F)(F)C(F)(F)OC(F)C(F)(F)F |
| InChI | InChI=1S/C18H12F22O6/c19-8(11(22,23)24)45-18(39,40)12(25,26)9(14(28,29)30,4-3-7(43)44)5(1-2-6(41)42)10(20,21)17(37,38)46-13(27,15(31,32)33)16(34,35)36/h5,8H,1-4H2,(H,41,42)(H,43,44) |
| InChIKey | FTTLBBPUIKJMRX-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.24 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|