About 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium
4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium (PubChem CID 58964020) has the molecular formula C27H30N3+3
and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium |
| PubChem CID | 58964020 |
| Molecular Formula | C27H30N3+3 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(Cc2cc(Cc3cc[n+](C)cc3)cc(Cc3cc[n+](C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H30N3/c1-28-10-4-22(5-11-28)16-25-19-26(17-23-6-12-29(2)13-7-23)21-27(20-25)18-24-8-14-30(3)15-9-24/h4-15,19-21H,16-18H2,1-3H3/q+3 |
| InChIKey | YEHNGKIRLVZABP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium?
The IUPAC name of 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium (CID 58964020) is 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium.
What is the SMILES notation for 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium?
The canonical SMILES for 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium is C[n+]1ccc(Cc2cc(Cc3cc[n+](C)cc3)cc(Cc3cc[n+](C)cc3)c2)cc1.
What is the InChIKey of 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium?
The InChIKey is YEHNGKIRLVZABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N3/c1-28-10-4-22(5-11-28)16-25-19-26(17-23-6-12-29(2)13-7-23)21-27(20-25)18-24-8-14-30(3)15-9-24/h4-15,19-21H,16-18H2,1-3H3/q+3.
What are the key properties of 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium?
4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium has a molecular weight of 396.56 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-bis[(1-methylpyridin-1-ium-4-yl)methyl]phenyl]methyl]-1-methylpyridin-1-ium is sourced from PubChem (CID 58964020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).