C25H31N4O4Y- — CID 58964147
[4-[2-carbamoyl-5-(6,6-dimethyl-4-oxo-5,7-dihydro-3H-indol-3-id-1-yl)anilino]cyclohexyl] 2-aminoacetate;yttrium (PubChem CID 58964147) has the molecular formula C25H31N4O4Y- and a molecular weight of 540.45 g/mol. Its IUPAC name is [4-[2-carbamoyl-5-(6,6-dimethyl-4-oxo-5,7-dihydro-3H-indol-3-id-1-yl)anilino]cyclohexyl] 2-aminoacetate;yttrium.
| Compound Name | [4-[2-carbamoyl-5-(6,6-dimethyl-4-oxo-5,7-dihydro-3H-indol-3-id-1-yl)anilino]cyclohexyl] 2-aminoacetate;yttrium |
|---|---|
| PubChem CID | 58964147 |
| Molecular Formula | C25H31N4O4Y- |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [4-[2-carbamoyl-5-(6,6-dimethyl-4-oxo-5,7-dihydro-3H-indol-3-id-1-yl)anilino]cyclohexyl] 2-aminoacetate;yttrium |
| SMILES | CC1(C)CC(=O)c2[c-]cn(-c3ccc(C(N)=O)c(NC4CCC(OC(=O)CN)CC4)c3)c2C1.[Y] |
| InChI | InChI=1S/C25H31N4O4.Y/c1-25(2)12-21-19(22(30)13-25)9-10-29(21)16-5-8-18(24(27)32)20(11-16)28-15-3-6-17(7-4-15)33-23(31)14-26;/h5,8,10-11,15,17,28H,3-4,6-7,12-14,26H2,1-2H3,(H2,27,32);/q-1; |
| InChIKey | SXWXWTKLYMNSME-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|