C8H18N2O2S — CID 58964382
3,3-di(propan-2-yl)-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 58964382) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 3,3-di(propan-2-yl)-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 3,3-di(propan-2-yl)-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 58964382 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3,3-di(propan-2-yl)-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | CC(C)C1(C(C)C)CNS(=O)(=O)N1 |
| InChI | InChI=1S/C8H18N2O2S/c1-6(2)8(7(3)4)5-9-13(11,12)10-8/h6-7,9-10H,5H2,1-4H3 |
| InChIKey | RCHQZTWBGLUJPH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |