C26H32N4O6S — CID 58964700
ethyl 2-[4-[[[2-[(Z)-[amino(thiophen-2-yl)methylidene]amino]oxy-2-oxoethyl]-(1,3-oxazol-2-ylmethyl)amino]methyl]-2,6-dimethylphenoxy]-2-methylpropanoate (PubChem CID 58964700) has the molecular formula C26H32N4O6S and a molecular weight of 528.63 g/mol. Its IUPAC name is ethyl 2-[4-[[[2-[(Z)-[amino(thiophen-2-yl)methylidene]amino]oxy-2-oxoethyl]-(1,3-oxazol-2-ylmethyl)amino]methyl]-2,6-dimethylphenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[[[2-[(Z)-[amino(thiophen-2-yl)methylidene]amino]oxy-2-oxoethyl]-(1,3-oxazol-2-ylmethyl)amino]methyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 58964700 |
| Molecular Formula | C26H32N4O6S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | ethyl 2-[4-[[[2-[(Z)-[amino(thiophen-2-yl)methylidene]amino]oxy-2-oxoethyl]-(1,3-oxazol-2-ylmethyl)amino]methyl]-2,6-dimethylphenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1c(C)cc(CN(CC(=O)O/N=C(\N)c2cccs2)Cc2ncco2)cc1C |
| InChI | InChI=1S/C26H32N4O6S/c1-6-33-25(32)26(4,5)35-23-17(2)12-19(13-18(23)3)14-30(15-21-28-9-10-34-21)16-22(31)36-29-24(27)20-8-7-11-37-20/h7-13H,6,14-16H2,1-5H3,(H2,27,29) |
| InChIKey | NGEZPQBQWNCLCU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|