C24H27N3O3 — CID 58964959
4-phenylmethoxy-1-[6-(2-piperidin-1-ylethoxy)-3-pyridinyl]pyridin-2-one (PubChem CID 58964959) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-phenylmethoxy-1-[6-(2-piperidin-1-ylethoxy)-3-pyridinyl]pyridin-2-one.
| Compound Name | 4-phenylmethoxy-1-[6-(2-piperidin-1-ylethoxy)-3-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 58964959 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-phenylmethoxy-1-[6-(2-piperidin-1-ylethoxy)-3-pyridinyl]pyridin-2-one |
| SMILES | O=c1cc(OCc2ccccc2)ccn1-c1ccc(OCCN2CCCCC2)nc1 |
| InChI | InChI=1S/C24H27N3O3/c28-24-17-22(30-19-20-7-3-1-4-8-20)11-14-27(24)21-9-10-23(25-18-21)29-16-15-26-12-5-2-6-13-26/h1,3-4,7-11,14,17-18H,2,5-6,12-13,15-16,19H2 |
| InChIKey | WWLLCTIQCGSIGP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |