About 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine
7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (PubChem CID 58965025) has the molecular formula C20H18FN3OS
and a molecular weight of 367.45 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| PubChem CID | 58965025 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| SMILES | CCCc1nc2c(N)nc3cc(OCc4ccc(F)cc4)ccc3c2s1 |
| InChI | InChI=1S/C20H18FN3OS/c1-2-3-17-24-18-19(26-17)15-9-8-14(10-16(15)23-20(18)22)25-11-12-4-6-13(21)7-5-12/h4-10H,2-3,11H2,1H3,(H2,22,23) |
| InChIKey | DETIARXAJNSPMQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The IUPAC name of 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (CID 58965025) is 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The canonical SMILES for 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine is CCCc1nc2c(N)nc3cc(OCc4ccc(F)cc4)ccc3c2s1.
What is the InChIKey of 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The InChIKey is DETIARXAJNSPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3OS/c1-2-3-17-24-18-19(26-17)15-9-8-14(10-16(15)23-20(18)22)25-11-12-4-6-13(21)7-5-12/h4-10H,2-3,11H2,1H3,(H2,22,23).
What are the key properties of 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine has a molecular weight of 367.45 g/mol, XLogP of 5.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(4-fluorophenyl)methoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 58965025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).