About 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine
7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (PubChem CID 58965036) has the molecular formula C21H20FN3OS
and a molecular weight of 381.48 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| PubChem CID | 58965036 |
| Molecular Formula | C21H20FN3OS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| SMILES | CCCc1nc2c(N)nc3cc(OCCc4ccc(F)cc4)ccc3c2s1 |
| InChI | InChI=1S/C21H20FN3OS/c1-2-3-18-25-19-20(27-18)16-9-8-15(12-17(16)24-21(19)23)26-11-10-13-4-6-14(22)7-5-13/h4-9,12H,2-3,10-11H2,1H3,(H2,23,24) |
| InChIKey | GKRUOUKNDYSFHI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The IUPAC name of 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (CID 58965036) is 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The canonical SMILES for 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine is CCCc1nc2c(N)nc3cc(OCCc4ccc(F)cc4)ccc3c2s1.
What is the InChIKey of 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The InChIKey is GKRUOUKNDYSFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3OS/c1-2-3-18-25-19-20(27-18)16-9-8-15(12-17(16)24-21(19)23)26-11-10-13-4-6-14(22)7-5-13/h4-9,12H,2-3,10-11H2,1H3,(H2,23,24).
What are the key properties of 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine?
7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine has a molecular weight of 381.48 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(4-fluorophenyl)ethoxy]-2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 58965036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).