About N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide
N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide (PubChem CID 58965638) has the molecular formula C12H13NO2S
and a molecular weight of 235.31 g/mol. Its IUPAC name is N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide.
Molecular Properties
| Compound Name | N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide |
| PubChem CID | 58965638 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide |
| SMILES | CCC(=O)NC1CSc2ccccc2C1=O |
| InChI | InChI=1S/C12H13NO2S/c1-2-11(14)13-9-7-16-10-6-4-3-5-8(10)12(9)15/h3-6,9H,2,7H2,1H3,(H,13,14) |
| InChIKey | BFBANHDULHGGHO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide?
The IUPAC name of N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide (CID 58965638) is N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide.
What is the SMILES notation for N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide?
The canonical SMILES for N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide is CCC(=O)NC1CSc2ccccc2C1=O.
What is the InChIKey of N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide?
The InChIKey is BFBANHDULHGGHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S/c1-2-11(14)13-9-7-16-10-6-4-3-5-8(10)12(9)15/h3-6,9H,2,7H2,1H3,(H,13,14).
What are the key properties of N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide?
N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide has a molecular weight of 235.31 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-oxo-2,3-dihydrothiochromen-3-yl)propanamide is sourced from PubChem (CID 58965638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).