About 7-methyltrideca-1,12-diene-5,9-diol
7-methyltrideca-1,12-diene-5,9-diol (PubChem CID 58965875) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 7-methyltrideca-1,12-diene-5,9-diol.
Molecular Properties
| Compound Name | 7-methyltrideca-1,12-diene-5,9-diol |
| PubChem CID | 58965875 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 7-methyltrideca-1,12-diene-5,9-diol |
| SMILES | C=CCCC(O)CC(C)CC(O)CCC=C |
| InChI | InChI=1S/C14H26O2/c1-4-6-8-13(15)10-12(3)11-14(16)9-7-5-2/h4-5,12-16H,1-2,6-11H2,3H3 |
| InChIKey | GWQNYEOYOZOBPS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyltrideca-1,12-diene-5,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyltrideca-1,12-diene-5,9-diol?
The IUPAC name of 7-methyltrideca-1,12-diene-5,9-diol (CID 58965875) is 7-methyltrideca-1,12-diene-5,9-diol.
What is the SMILES notation for 7-methyltrideca-1,12-diene-5,9-diol?
The canonical SMILES for 7-methyltrideca-1,12-diene-5,9-diol is C=CCCC(O)CC(C)CC(O)CCC=C.
What is the InChIKey of 7-methyltrideca-1,12-diene-5,9-diol?
The InChIKey is GWQNYEOYOZOBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-4-6-8-13(15)10-12(3)11-14(16)9-7-5-2/h4-5,12-16H,1-2,6-11H2,3H3.
What are the key properties of 7-methyltrideca-1,12-diene-5,9-diol?
7-methyltrideca-1,12-diene-5,9-diol has a molecular weight of 226.36 g/mol, XLogP of 3.06, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyltrideca-1,12-diene-5,9-diol is sourced from PubChem (CID 58965875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).