C41H48N2O4 — CID 58965906
5-[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 58965906) has the molecular formula C41H48N2O4 and a molecular weight of 632.85 g/mol. Its IUPAC name is 5-[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 58965906 |
| Molecular Formula | C41H48N2O4 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | 5-[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]cyclopentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCN1/C(=C/C=C2\CC/C(=C\C=C3\N(CC)c4ccc(C)cc4C3(C)C)C2=C2C(=O)OC(C)(C)OC2=O)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C41H48N2O4/c1-11-42-31-19-13-25(3)23-29(31)39(5,6)33(42)21-17-27-15-16-28(35(27)36-37(44)46-41(9,10)47-38(36)45)18-22-34-40(7,8)30-24-26(4)14-20-32(30)43(34)12-2/h13-14,17-24H,11-12,15-16H2,1-10H3/b27-17+,28-18+,33-21+,34-22+ |
| InChIKey | PWWKVLVMLBWXDM-IABZKBHHSA-N |
| XLogP | 8.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|