C47H50N3O2+ — CID 58965910
[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)ethylidene]cyclopent-3-en-1-ylidene]-diphenylazanium (PubChem CID 58965910) has the molecular formula C47H50N3O2+ and a molecular weight of 688.94 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)ethylidene]cyclopent-3-en-1-ylidene]-diphenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)ethylidene]cyclopent-3-en-1-ylidene]-diphenylazanium |
|---|---|
| PubChem CID | 58965910 |
| Molecular Formula | C47H50N3O2+ |
| Molecular Weight | 688.94 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)ethylidene]cyclopent-3-en-1-ylidene]-diphenylazanium |
| SMILES | CCN1/C(=C/C=C2\C=C/C(=C\C=C3\N(CC)c4ccc(OC)cc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C47H50N3O2/c1-9-48-41-27-25-37(51-7)31-39(41)46(3,4)43(48)29-23-33-21-22-34(45(33)50(35-17-13-11-14-18-35)36-19-15-12-16-20-36)24-30-44-47(5,6)40-32-38(52-8)26-28-42(40)49(44)10-2/h11-32H,9-10H2,1-8H3/q+1 |
| InChIKey | DMHPBGVTLFLKFY-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 27.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.94 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|