C23H21N3O5 — CID 58966048
2-[3-carbamoyl-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]benzoic acid (PubChem CID 58966048) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-[3-carbamoyl-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]benzoic acid.
| Compound Name | 2-[3-carbamoyl-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 58966048 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[3-carbamoyl-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]benzoic acid |
| SMILES | CC1=C(C(N)=O)C(=O)N(c2ccccc2C(=O)O)C(=O)C1=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H21N3O5/c1-13-17(12-14-8-10-15(11-9-14)25(2)3)21(28)26(22(29)19(13)20(24)27)18-7-5-4-6-16(18)23(30)31/h4-12H,1-3H3,(H2,24,27)(H,30,31) |
| InChIKey | KOLYFLVUHBOZGC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|