C25H23F5N2O4S — CID 58966288
[2-[N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-pentoxy-3-(trifluoromethyl)anilino]-2-oxoethyl] acetate (PubChem CID 58966288) has the molecular formula C25H23F5N2O4S and a molecular weight of 542.53 g/mol. Its IUPAC name is [2-[N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-pentoxy-3-(trifluoromethyl)anilino]-2-oxoethyl] acetate.
| Compound Name | [2-[N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-pentoxy-3-(trifluoromethyl)anilino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 58966288 |
| Molecular Formula | C25H23F5N2O4S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | [2-[N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-pentoxy-3-(trifluoromethyl)anilino]-2-oxoethyl] acetate |
| SMILES | CCCCCOc1ccc(N(C(=O)COC(C)=O)c2nc(-c3ccc(F)c(F)c3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H23F5N2O4S/c1-3-4-5-10-35-22-9-7-17(12-18(22)25(28,29)30)32(23(34)13-36-15(2)33)24-31-21(14-37-24)16-6-8-19(26)20(27)11-16/h6-9,11-12,14H,3-5,10,13H2,1-2H3 |
| InChIKey | BVIIZTVVVWKVTB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|