C17H20N2O4 — CID 58966671
8-(1,3-oxazol-2-yl)-4-pentyl-2,3-dihydro-1,4-benzoxazine-6-carboxylic acid (PubChem CID 58966671) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 8-(1,3-oxazol-2-yl)-4-pentyl-2,3-dihydro-1,4-benzoxazine-6-carboxylic acid.
| Compound Name | 8-(1,3-oxazol-2-yl)-4-pentyl-2,3-dihydro-1,4-benzoxazine-6-carboxylic acid |
|---|---|
| PubChem CID | 58966671 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 8-(1,3-oxazol-2-yl)-4-pentyl-2,3-dihydro-1,4-benzoxazine-6-carboxylic acid |
| SMILES | CCCCCN1CCOc2c(-c3ncco3)cc(C(=O)O)cc21 |
| InChI | InChI=1S/C17H20N2O4/c1-2-3-4-6-19-7-9-22-15-13(16-18-5-8-23-16)10-12(17(20)21)11-14(15)19/h5,8,10-11H,2-4,6-7,9H2,1H3,(H,20,21) |
| InChIKey | HHPXZMHJJWIELH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|