C33H37F2N3O3 — CID 58966770
1-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-formylindole-6-carboxamide (PubChem CID 58966770) has the molecular formula C33H37F2N3O3 and a molecular weight of 561.67 g/mol. Its IUPAC name is 1-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-formylindole-6-carboxamide.
| Compound Name | 1-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-formylindole-6-carboxamide |
|---|---|
| PubChem CID | 58966770 |
| Molecular Formula | C33H37F2N3O3 |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 1-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-formylindole-6-carboxamide |
| SMILES | CCCCn1cc(C=O)c2ccc(C(=O)N[C@@H](Cc3cc(F)cc(F)c3)[C@H](O)CNCc3cccc(CC)c3)cc21 |
| InChI | InChI=1S/C33H37F2N3O3/c1-3-5-11-38-20-26(21-39)29-10-9-25(16-31(29)38)33(41)37-30(15-24-13-27(34)17-28(35)14-24)32(40)19-36-18-23-8-6-7-22(4-2)12-23/h6-10,12-14,16-17,20-21,30,32,36,40H,3-5,11,15,18-19H2,1-2H3,(H,37,41)/t30-,32+/m0/s1 |
| InChIKey | ISAVMQJNFHWQOV-XDFJSJKPSA-N |
| XLogP | 5.59 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|