C20H24BrNO4 — CID 58966799
8'-bromo-10'-methoxy-5'-methylspiro[1,3-dioxolane-2,15'-12-oxa-5-azatetracyclo[9.6.1.01,13.07,18]octadeca-7,9,11(18),16-tetraene] (PubChem CID 58966799) has the molecular formula C20H24BrNO4 and a molecular weight of 422.32 g/mol. Its IUPAC name is 8'-bromo-10'-methoxy-5'-methylspiro[1,3-dioxolane-2,15'-12-oxa-5-azatetracyclo[9.6.1.01,13.07,18]octadeca-7,9,11(18),16-tetraene].
| Compound Name | 8'-bromo-10'-methoxy-5'-methylspiro[1,3-dioxolane-2,15'-12-oxa-5-azatetracyclo[9.6.1.01,13.07,18]octadeca-7,9,11(18),16-tetraene] |
|---|---|
| PubChem CID | 58966799 |
| Molecular Formula | C20H24BrNO4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 8'-bromo-10'-methoxy-5'-methylspiro[1,3-dioxolane-2,15'-12-oxa-5-azatetracyclo[9.6.1.01,13.07,18]octadeca-7,9,11(18),16-tetraene] |
| SMILES | COc1cc(Br)c2c3c1OC1CC4(C=CC31CCCN(C)C2)OCCO4 |
| InChI | InChI=1S/C20H24BrNO4/c1-22-7-3-4-19-5-6-20(24-8-9-25-20)11-16(19)26-18-15(23-2)10-14(21)13(12-22)17(18)19/h5-6,10,16H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | NKLNYVZJPIJPCY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|