C33H38ClN5O3 — CID 58967337
3-[5-[2-(4-chlorophenyl)ethoxy]-2-[6-(2-imidazol-1-ylethoxy)-1H-benzimidazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 58967337) has the molecular formula C33H38ClN5O3 and a molecular weight of 588.15 g/mol. Its IUPAC name is 3-[5-[2-(4-chlorophenyl)ethoxy]-2-[6-(2-imidazol-1-ylethoxy)-1H-benzimidazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[5-[2-(4-chlorophenyl)ethoxy]-2-[6-(2-imidazol-1-ylethoxy)-1H-benzimidazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 58967337 |
| Molecular Formula | C33H38ClN5O3 |
| Molecular Weight | 588.15 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 3-[5-[2-(4-chlorophenyl)ethoxy]-2-[6-(2-imidazol-1-ylethoxy)-1H-benzimidazol-2-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1cc(OCCc2ccc(Cl)cc2)ccc1-c1nc2ccc(OCCn3ccnc3)cc2[nH]1 |
| InChI | InChI=1S/C33H38ClN5O3/c1-3-38(4-2)16-5-19-42-32-23-28(40-20-14-25-6-8-26(34)9-7-25)10-12-29(32)33-36-30-13-11-27(22-31(30)37-33)41-21-18-39-17-15-35-24-39/h6-13,15,17,22-24H,3-5,14,16,18-21H2,1-2H3,(H,36,37) |
| InChIKey | VBFJXLNFMXBIHL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.15 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|