About ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 58967440) has the molecular formula C16H27F2NO4
and a molecular weight of 335.39 g/mol. Its IUPAC name is ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| PubChem CID | 58967440 |
| Molecular Formula | C16H27F2NO4 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(CC1CCC(F)(F)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27F2NO4/c1-5-22-13(20)12(19-14(21)23-15(2,3)4)10-11-6-8-16(17,18)9-7-11/h11-12H,5-10H2,1-4H3,(H,19,21) |
| InChIKey | QYUNXNWOIHYKOV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The IUPAC name of ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CID 58967440) is ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
What is the SMILES notation for ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The canonical SMILES for ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is CCOC(=O)C(CC1CCC(F)(F)CC1)NC(=O)OC(C)(C)C.
What is the InChIKey of ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The InChIKey is QYUNXNWOIHYKOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27F2NO4/c1-5-22-13(20)12(19-14(21)23-15(2,3)4)10-11-6-8-16(17,18)9-7-11/h11-12H,5-10H2,1-4H3,(H,19,21).
What are the key properties of ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate has a molecular weight of 335.39 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4,4-difluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is sourced from PubChem (CID 58967440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).