C25H24F3N3O2 — CID 58967703
2,2,2-trifluoro-1-[1-[3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]indol-3-yl]ethanone (PubChem CID 58967703) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]indol-3-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-[3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 58967703 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propyl]indol-3-yl]ethanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(CCCn1cc(C(=O)C(F)(F)F)c2ccccc21)C3 |
| InChI | InChI=1S/C25H24F3N3O2/c1-33-16-7-8-21-19(13-16)17-9-12-30(15-22(17)29-21)10-4-11-31-14-20(24(32)25(26,27)28)18-5-2-3-6-23(18)31/h2-3,5-8,13-14,29H,4,9-12,15H2,1H3 |
| InChIKey | JCYJDPQUBINSKC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|