C27H31N3O3 — CID 58968211
N-methoxy-1-[3-(6-methoxy-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)propyl]-N-methylindole-3-carboxamide (PubChem CID 58968211) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-methoxy-1-[3-(6-methoxy-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)propyl]-N-methylindole-3-carboxamide.
| Compound Name | N-methoxy-1-[3-(6-methoxy-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)propyl]-N-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 58968211 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-methoxy-1-[3-(6-methoxy-1,3,4,9-tetrahydroindeno[2,1-c]pyridin-2-yl)propyl]-N-methylindole-3-carboxamide |
| SMILES | COc1ccc2c(c1)C1=C(C2)CN(CCCn2cc(C(=O)N(C)OC)c3ccccc32)CC1 |
| InChI | InChI=1S/C27H31N3O3/c1-28(33-3)27(31)25-18-30(26-8-5-4-7-23(25)26)13-6-12-29-14-11-22-20(17-29)15-19-9-10-21(32-2)16-24(19)22/h4-5,7-10,16,18H,6,11-15,17H2,1-3H3 |
| InChIKey | SIABFNLTMUOQTE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|