C63H60F6 — CID 58969152
2-[(9Z)-9-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-7-phenylfluoren-2-yl]-9,9-dioctyl-7-phenylfluorene (PubChem CID 58969152) has the molecular formula C63H60F6 and a molecular weight of 931.16 g/mol. Its IUPAC name is 2-[(9Z)-9-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-7-phenylfluoren-2-yl]-9,9-dioctyl-7-phenylfluorene.
| Compound Name | 2-[(9Z)-9-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-7-phenylfluoren-2-yl]-9,9-dioctyl-7-phenylfluorene |
|---|---|
| PubChem CID | 58969152 |
| Molecular Formula | C63H60F6 |
| Molecular Weight | 931.16 g/mol |
| Exact Mass | 930.46 |
| IUPAC Name | 2-[(9Z)-9-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-7-phenylfluoren-2-yl]-9,9-dioctyl-7-phenylfluorene |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3ccccc3)ccc2-c2ccc(-c3ccc4c(c3)/C(=C\c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3cc(-c5ccccc5)ccc3-4)cc21 |
| InChI | InChI=1S/C63H60F6/c1-3-5-7-9-11-19-33-61(34-20-12-10-8-6-4-2)59-40-48(45-23-17-14-18-24-45)27-31-54(59)55-32-28-49(41-60(55)61)47-26-30-53-52-29-25-46(44-21-15-13-16-22-44)38-57(52)56(58(53)39-47)37-43-35-50(62(64,65)66)42-51(36-43)63(67,68)69/h13-18,21-32,35-42H,3-12,19-20,33-34H2,1-2H3/b56-37- |
| InChIKey | HLPNJEBWOZYXSB-OYTPLCDKSA-N |
| XLogP | 20.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.16 |
| LogP ≤ 5 | 20.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|