C27H33N9O7 — CID 58969491
(2S,3S)-2-azaniumyl-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanoate (PubChem CID 58969491) has the molecular formula C27H33N9O7 and a molecular weight of 595.62 g/mol. Its IUPAC name is (2S,3S)-2-azaniumyl-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanoate.
| Compound Name | (2S,3S)-2-azaniumyl-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 58969491 |
| Molecular Formula | C27H33N9O7 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (2S,3S)-2-azaniumyl-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanoate |
| SMILES | [NH3+][C@H](C(=O)[O-])[C@@H](O)c1ccnc(CN2CCN(Cc3cc([N+](=O)[O-])ccn3)CCN(Cc3cc([N+](=O)[O-])ccn3)CC2)c1 |
| InChI | InChI=1S/C27H33N9O7/c28-25(27(38)39)26(37)19-1-4-29-20(13-19)16-32-7-9-33(17-21-14-23(35(40)41)2-5-30-21)11-12-34(10-8-32)18-22-15-24(36(42)43)3-6-31-22/h1-6,13-15,25-26,37H,7-12,16-18,28H2,(H,38,39)/t25-,26-/m0/s1 |
| InChIKey | RCOGJWDZUIXXCL-UIOOFZCWSA-N |
| XLogP | -1.10 |
| TPSA | 222.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|