C23H26N4O4 — CID 58969652
[3-[[8-(4-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]amino]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 58969652) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is [3-[[8-(4-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]amino]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[8-(4-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58969652 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [3-[[8-(4-tert-butyl-2-hydroxyphenyl)-7,8,9-triazatricyclo[4.3.0.07,9]nona-1(6),2,4-trien-3-yl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)Nc1ccc2c(c1)n1n(-c3ccc(C(C)(C)C)cc3O)n21 |
| InChI | InChI=1S/C23H26N4O4/c1-14(2)22(30)31-11-10-21(29)24-16-7-9-17-19(13-16)27-25(17)26(27)18-8-6-15(12-20(18)28)23(3,4)5/h6-9,12-13,28H,1,10-11H2,2-5H3,(H,24,29) |
| InChIKey | GIWXBEPGMAGRNS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|